Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...")
(Created page with "Category:metabolite == Metabolite CPD-9406 == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-D-XYLOSE ==
+
== Metabolite CPD-9406 ==
 
* common-name:
 
* common-name:
** udp-α-d-xylose
+
** (2s)-ethylmalonyl-coa
 
* smiles:
 
* smiles:
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
+
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** dqqdlyvhotzlor-ocimbmbzsa-l
+
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
* molecular-weight:
** 534.263
+
** 876.595
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.2.26-RXN]]
+
* [[RXN-13029]]
* [[2.4.2.38-RXN]]
 
* [[2.7.7.11-RXN]]
 
* [[RXN-9104]]
 
* [[UA4E]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.11-RXN]]
+
* [[RXN-13029]]
* [[UA4E]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UGDC]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-xylose}}
+
{{#set: common-name=(2s)-ethylmalonyl-coa}}
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
+
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
{{#set: molecular-weight=534.263}}
+
{{#set: molecular-weight=876.595}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-9406

  • common-name:
    • (2s)-ethylmalonyl-coa
  • smiles:
    • ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
  • inchi-key:
    • vugzqvcbbbezqe-uqcjfraesa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality