Difference between revisions of "CPD-10809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12677 == * common-name: ** 5-chloro-5-deoxyribose 1-phosphate * smiles: ** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1) * inchi-key: ** dgv...")
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_RIBOSE == * common-name: ** 1-(β-d ribofuranosyl)nicotinamide * smiles: ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12677 ==
+
== Metabolite NICOTINAMIDE_RIBOSE ==
 
* common-name:
 
* common-name:
** 5-chloro-5-deoxyribose 1-phosphate
+
** 1-(β-d ribofuranosyl)nicotinamide
 
* smiles:
 
* smiles:
** c(cl)c1(c(o)c(o)c(op([o-])(=o)[o-])o1)
+
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
 
* inchi-key:
 
* inchi-key:
** dgviesznpvjdpq-soofdhnksa-l
+
** jlebzpbdrkpwtd-turqnecasa-o
 
* molecular-weight:
 
* molecular-weight:
** 246.541
+
** 255.25
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11715]]
+
* [[RXN-5841]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-chloro-5-deoxyribose 1-phosphate}}
+
{{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}}
{{#set: inchi-key=inchikey=dgviesznpvjdpq-soofdhnksa-l}}
+
{{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}}
{{#set: molecular-weight=246.541}}
+
{{#set: molecular-weight=255.25}}

Revision as of 18:59, 14 January 2021

Metabolite NICOTINAMIDE_RIBOSE

  • common-name:
    • 1-(β-d ribofuranosyl)nicotinamide
  • smiles:
    • c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
  • inchi-key:
    • jlebzpbdrkpwtd-turqnecasa-o
  • molecular-weight:
    • 255.25

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality