Difference between revisions of "Beta-D-glucan-w-C-3-substitution"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
(Created page with "Category:metabolite == Metabolite D-galactopyranose == * common-name: ** d-galactopyranose == Reaction(s) known to consume the compound == * RXN-12078 * TRANS-RXN-21...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-galactopyranose == |
* common-name: | * common-name: | ||
− | ** | + | ** d-galactopyranose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12078]] |
+ | * [[TRANS-RXN-21]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[3.2.1.23-RXN]] | ||
+ | * [[ALPHAGALACTOSID-RXN]] | ||
+ | * [[RXN-12078]] | ||
+ | * [[RXN-12398]] | ||
+ | * [[RXN-12399]] | ||
+ | * [[RXN-12400]] | ||
+ | * [[RXN-17830]] | ||
+ | * [[TRANS-RXN-21]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-galactopyranose}} |
− | |||
− |
Revision as of 11:12, 15 January 2021
Contents
Metabolite D-galactopyranose
- common-name:
- d-galactopyranose