Difference between revisions of "CARBAMYUL-L-ASPARTATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...")
(Created page with "Category:metabolite == Metabolite CPD-597 == * common-name: ** n-carbamoylputrescine * smiles: ** c(cccnc(n)=o)[n+] * inchi-key: ** yanfyyganiyhgi-uhfffaoysa-o * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMYUL-L-ASPARTATE ==
+
== Metabolite CPD-597 ==
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** n-carbamoylputrescine
 
* smiles:
 
* smiles:
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
+
** c(cccnc(n)=o)[n+]
 
* inchi-key:
 
* inchi-key:
** hlkxyzvtanabhz-reohclbhsa-l
+
** yanfyyganiyhgi-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 174.113
+
** 132.185
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[AGMATINE-DEIMINASE-RXN]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-carbamoyl-l-aspartate}}
+
{{#set: common-name=n-carbamoylputrescine}}
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=yanfyyganiyhgi-uhfffaoysa-o}}
{{#set: molecular-weight=174.113}}
+
{{#set: molecular-weight=132.185}}

Revision as of 11:12, 15 January 2021

Metabolite CPD-597

  • common-name:
    • n-carbamoylputrescine
  • smiles:
    • c(cccnc(n)=o)[n+]
  • inchi-key:
    • yanfyyganiyhgi-uhfffaoysa-o
  • molecular-weight:
    • 132.185

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality