Difference between revisions of "3-oxo-lignoceroyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2244 == * common-name: ** (s)-3-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1...")
(Created page with "Category:metabolite == Metabolite CPD1F-138 == * common-name: ** gibberellin a12-aldehyde * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2244 ==
+
== Metabolite CPD1F-138 ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxydecanoyl-coa
+
** gibberellin a12-aldehyde
 
* smiles:
 
* smiles:
** cccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(oc(c(c1op([o-])(=o)[o-])o)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
 
* inchi-key:
 
* inchi-key:
** hivsmyzamunfkz-pnpvfpmqsa-j
+
** zctunyrxjklwpy-llcokinksa-m
 
* molecular-weight:
 
* molecular-weight:
** 933.753
+
** 315.431
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH4h]]
+
* [[RXN1F-161]]
* [[HACD4h]]
 
* [[RXN-12490]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH4h]]
+
* [[RXN1F-160]]
* [[HACD4h]]
 
* [[RXN-13616]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxydecanoyl-coa}}
+
{{#set: common-name=gibberellin a12-aldehyde}}
{{#set: inchi-key=inchikey=hivsmyzamunfkz-pnpvfpmqsa-j}}
+
{{#set: inchi-key=inchikey=zctunyrxjklwpy-llcokinksa-m}}
{{#set: molecular-weight=933.753}}
+
{{#set: molecular-weight=315.431}}

Revision as of 11:13, 15 January 2021

Metabolite CPD1F-138

  • common-name:
    • gibberellin a12-aldehyde
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
  • inchi-key:
    • zctunyrxjklwpy-llcokinksa-m
  • molecular-weight:
    • 315.431

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality