Difference between revisions of "CPD-9039"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
(Created page with "Category:metabolite == Metabolite Soluble-Heteroglycans == * common-name: ** a plant soluble heteroglycan == Reaction(s) known to consume the compound == * RXN-14353 =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10269 ==
+
== Metabolite Soluble-Heteroglycans ==
 
* common-name:
 
* common-name:
** palmitoleoyl-coa
+
** a plant soluble heteroglycan
* smiles:
 
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** qbyoccwnzaoztl-mdmkaecgsa-j
 
* molecular-weight:
 
** 999.899
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10662]]
+
* [[RXN-14353]]
* [[RXN-17008]]
 
* [[RXN-17009]]
 
* [[RXN-17019]]
 
* [[RXN-17788]]
 
* [[RXN-9616]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10664]]
+
* [[RXN-14353]]
* [[RXN-17787]]
 
* [[RXN0-7248]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleoyl-coa}}
+
{{#set: common-name=a plant soluble heteroglycan}}
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
 
{{#set: molecular-weight=999.899}}
 

Revision as of 11:13, 15 January 2021

Metabolite Soluble-Heteroglycans

  • common-name:
    • a plant soluble heteroglycan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality