Difference between revisions of "2-HYDROXY-2-METHYLPROPANENITRILE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...") |
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OROTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** orotate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxqpewdeaktcgb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.09 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OROPRIBTRANS-RXN]] |
| − | + | * [[ORPRT]] | |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[OROPRIBTRANS-RXN]] |
| − | * [[ | + | * [[ORPRT]] |
| − | * [[ | + | * [[RXN0-6491]] |
| − | * [[ | + | * [[RXN0-6554]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=orotate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.09}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite OROTATE
- common-name:
- orotate
- smiles:
- c1(=c(c([o-])=o)nc(nc(=o)1)=o)
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09
