Difference between revisions of "CDP-CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3457-TETRAHYDROXY-3-METHOXYFLAVONE == * common-name: ** 3-o-methylquercetin * smiles: ** coc3(c(=o)c1(c(=cc([o-])=cc(o)=1)oc(c2(c=c(o)c(o...")
(Created page with "Category:metabolite == Metabolite CPD-8974 == * common-name: ** dimethylthiophosphate * smiles: ** cop([o-])(=s)oc * inchi-key: ** wwjjvkaeqggyhj-uhfffaoysa-m * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3457-TETRAHYDROXY-3-METHOXYFLAVONE ==
+
== Metabolite CPD-8974 ==
 
* common-name:
 
* common-name:
** 3-o-methylquercetin
+
** dimethylthiophosphate
 
* smiles:
 
* smiles:
** coc3(c(=o)c1(c(=cc([o-])=cc(o)=1)oc(c2(c=c(o)c(o)=cc=2))=3))
+
** cop([o-])(=s)oc
 
* inchi-key:
 
* inchi-key:
** wepbgsiawztejr-uhfffaoysa-m
+
** wwjjvkaeqggyhj-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 315.259
+
** 141.101
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
+
* [[RXN-8743]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-o-methylquercetin}}
+
{{#set: common-name=dimethylthiophosphate}}
{{#set: inchi-key=inchikey=wepbgsiawztejr-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=wwjjvkaeqggyhj-uhfffaoysa-m}}
{{#set: molecular-weight=315.259}}
+
{{#set: molecular-weight=141.101}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-8974

  • common-name:
    • dimethylthiophosphate
  • smiles:
    • cop([o-])(=s)oc
  • inchi-key:
    • wwjjvkaeqggyhj-uhfffaoysa-m
  • molecular-weight:
    • 141.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality