Difference between revisions of "Oxidized-flavodoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6082 == * common-name: ** 3-aminopropanal * smiles: ** c(cc[n+])=o * inchi-key: ** pcxdjqzlddhmgx-uhfffaoysa-o * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6082 ==
+
== Metabolite CPD-7280 ==
 
* common-name:
 
* common-name:
** 3-aminopropanal
+
** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
 
* smiles:
 
* smiles:
** c(cc[n+])=o
+
** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
 
* inchi-key:
 
* inchi-key:
** pcxdjqzlddhmgx-uhfffaoysa-o
+
** fyydcjdefsyvoy-wenurhbksa-n
 
* molecular-weight:
 
* molecular-weight:
** 74.102
+
** 382.542
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-aminopropanal}}
+
{{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
{{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}}
{{#set: molecular-weight=74.102}}
+
{{#set: molecular-weight=382.542}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-7280

  • common-name:
    • (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
  • smiles:
    • cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
  • inchi-key:
    • fyydcjdefsyvoy-wenurhbksa-n
  • molecular-weight:
    • 382.542

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality