Difference between revisions of "CPD-8678"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11497 == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(o)c=cc(c(o)co)=c1) * inchi-key: ** fbwpwwwzwkpjfl-qmm...") |
(Created page with "Category:metabolite == Metabolite III2-a-Fucosyllactotetraosylceramides == * common-name: ** a iii2-α-fucosyllactotetraosylceramide == Reaction(s) known to consume t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite III2-a-Fucosyllactotetraosylceramides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a iii2-α-fucosyllactotetraosylceramide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a iii2-α-fucosyllactotetraosylceramide}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite III2-a-Fucosyllactotetraosylceramides
- common-name:
- a iii2-α-fucosyllactotetraosylceramide
