Difference between revisions of "D-Xylopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CHITOBIOSE == * common-name: ** n,n'-diacetylchitobiose == Reaction(s) known to consume the compound == * RXN-12625 == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * smiles: ** c2([n+]=cn(c1(oc(cop(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CHITOBIOSE ==
+
== Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** n,n'-diacetylchitobiose
+
** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
 +
* smiles:
 +
** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
 +
* inchi-key:
 +
** pdacukokvhbvhj-xvfcmesisa-m
 +
* molecular-weight:
 +
** 294.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12625]]
+
* [[AIRCARBOXY-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12554]]
+
* [[AIRCARBOXY-RXN]]
* [[RXN-12623]]
+
* [[AIRS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n,n'-diacetylchitobiose}}
+
{{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}}
 +
{{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}}
 +
{{#set: molecular-weight=294.18}}

Revision as of 11:14, 15 January 2021

Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE

  • common-name:
    • 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
  • smiles:
    • c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
  • inchi-key:
    • pdacukokvhbvhj-xvfcmesisa-m
  • molecular-weight:
    • 294.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality