Difference between revisions of "DEOXY-RIBOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
(Created page with "Category:metabolite == Metabolite Oxidized-2Fe-2S-Ferredoxins == * common-name: ** an oxidized [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == == React...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Oxidized-2Fe-2S-Ferredoxins == |
* common-name: | * common-name: | ||
− | ** | + | ** an oxidized [2fe-2s] ferredoxin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.8.1.6-RXN]] | ||
+ | * [[RXN-11586]] | ||
+ | * [[RXN-14950]] | ||
+ | * [[RXN-14957]] | ||
+ | * [[RXN-14959]] | ||
* [[RXN-17472]] | * [[RXN-17472]] | ||
+ | * [[RXN0-949]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an oxidized [2fe-2s] ferredoxin}} |
− | |||
− |
Revision as of 11:14, 15 January 2021
Contents
Metabolite Oxidized-2Fe-2S-Ferredoxins
- common-name:
- an oxidized [2fe-2s] ferredoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an oxidized [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.