Difference between revisions of "DGMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc...")
(Created page with "Category:metabolite == Metabolite Ox-Glutaredoxins == * common-name: ** an oxidized glutaredoxin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11520 ==
+
== Metabolite Ox-Glutaredoxins ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
+
** an oxidized glutaredoxin
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** yyccmactoajggw-ozvhgmpnsa-j
 
* molecular-weight:
 
** 1053.904
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10699]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10698]]
+
* [[RXN-982]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
+
{{#set: common-name=an oxidized glutaredoxin}}
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
 
{{#set: molecular-weight=1053.904}}
 

Revision as of 11:14, 15 January 2021

Metabolite Ox-Glutaredoxins

  • common-name:
    • an oxidized glutaredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality