Difference between revisions of "CPD-4568"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL == * common-name: ** n-methyl-(r,s)-tetrahydrobenzylisoquinoline * smiles: ** c[n+]1(c(c2(c(cc1)=cc...")
(Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * smiles: ** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL ==
+
== Metabolite CPD-13576 ==
 
* common-name:
 
* common-name:
** n-methyl-(r,s)-tetrahydrobenzylisoquinoline
+
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
 
* smiles:
 
* smiles:
** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
+
** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
 
* inchi-key:
 
* inchi-key:
** vkrkvllltihdef-uhfffaoysa-o
+
** xwecmahakfwynv-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 238.352
+
** 264.169
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12610]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.115-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}}
+
{{#set: common-name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
{{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=xwecmahakfwynv-uhfffaoysa-k}}
{{#set: molecular-weight=238.352}}
+
{{#set: molecular-weight=264.169}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-13576

  • common-name:
    • 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
  • smiles:
    • cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
  • inchi-key:
    • xwecmahakfwynv-uhfffaoysa-k
  • molecular-weight:
    • 264.169

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality