Difference between revisions of "METHYLENE-THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-27 == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) * inchi...") |
(Created page with "Category:metabolite == Metabolite DEPHOSPHO-COA == * common-name: ** 3'-dephospho-coa * smiles: ** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEPHOSPHO-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** 3'-dephospho-coa |
* smiles: | * smiles: | ||
− | ** cc(=o) | + | ** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kdtshfargakyjn-ibosznhhsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 685.538 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADCPT]] |
+ | * [[DEPHOSPHOCOAKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PANTEPADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3'-dephospho-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=685.538}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite DEPHOSPHO-COA
- common-name:
- 3'-dephospho-coa
- smiles:
- cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
- inchi-key:
- kdtshfargakyjn-ibosznhhsa-l
- molecular-weight:
- 685.538