Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11592 == * smiles: ** cc(c)=ccnc3(c2(n=cn(c1(oc(cop(=o)([o-])o[a trna])c(op([o-])(=o)o[a trna])c(o)1))c=2n=c(sc)n=3)) * common-name:...") |
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15301 == |
+ | * common-name: | ||
+ | ** caldariellaquinol | ||
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** uvcqokdzgiahdg-uhfffaoysa-n |
+ | * molecular-weight: | ||
+ | ** 633.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15378]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=caldariellaquinol}} |
+ | {{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=633.085}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-15301
- common-name:
- caldariellaquinol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
- inchi-key:
- uvcqokdzgiahdg-uhfffaoysa-n
- molecular-weight:
- 633.085