Difference between revisions of "CPD0-2340"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACYL-GPE == * common-name: ** a 2-acyl-1-lyso-phosphatidylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite 2 | + | == Metabolite CPD1F-2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (-)-methyl jasmonate |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(=o)ccc1cc(oc)=o) | ||
| + | * inchi-key: | ||
| + | ** gewdntwnsazudx-wqmvxfaesa-n | ||
| + | * molecular-weight: | ||
| + | ** 224.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10767]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-methyl jasmonate}} |
| + | {{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}} | ||
| + | {{#set: molecular-weight=224.299}} | ||
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD1F-2
- common-name:
- (-)-methyl jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc(oc)=o)
- inchi-key:
- gewdntwnsazudx-wqmvxfaesa-n
- molecular-weight:
- 224.299
