Difference between revisions of "TRNA-pseudouridine32"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...") |
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Unsulfurated-Sulfur-Acceptors == |
* common-name: | * common-name: | ||
− | ** | + | ** an unsulfurated [sulfur carrier] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12587]] |
+ | * [[RXN-12588]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.8.1.6-RXN]] |
− | * [[ | + | * [[RXN-12587]] |
+ | * [[RXN-14480]] | ||
+ | * [[RXN-14950]] | ||
+ | * [[RXN-14957]] | ||
+ | * [[RXN-14959]] | ||
+ | * [[RXN-17472]] | ||
+ | * [[RXN0-5063]] | ||
+ | * [[RXN0-6359]] | ||
+ | * [[RXN0-949]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an unsulfurated [sulfur carrier]}} |
− | |||
− |
Revision as of 11:15, 15 January 2021
Contents
Metabolite Unsulfurated-Sulfur-Acceptors
- common-name:
- an unsulfurated [sulfur carrier]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 2.8.1.6-RXN
- RXN-12587
- RXN-14480
- RXN-14950
- RXN-14957
- RXN-14959
- RXN-17472
- RXN0-5063
- RXN0-6359
- RXN0-949
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an unsulfurated [sulfur carrier" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.