Difference between revisions of "GAMA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Tetradec-2-enoyl-ACPs == * common-name: ** a trans tetradec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9538...") |
(Created page with "Category:metabolite == Metabolite CPD-15655 == * common-name: ** (3e)-undec-3-enoyl-coa * smiles: ** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15655 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3e)-undec-3-enoyl-coa |
+ | * smiles: | ||
+ | ** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** hvxccjiyxizgop-nadloitosa-j | ||
+ | * molecular-weight: | ||
+ | ** 929.765 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14776]] |
+ | * [[RXN-14790]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3e)-undec-3-enoyl-coa}} |
+ | {{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}} | ||
+ | {{#set: molecular-weight=929.765}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-15655
- common-name:
- (3e)-undec-3-enoyl-coa
- smiles:
- cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hvxccjiyxizgop-nadloitosa-j
- molecular-weight:
- 929.765