Difference between revisions of "1-3-alpha-D-Glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite GLT == * common-name: ** l-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxjrkmk-vkhmyheasa-m * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9858 ==
+
== Metabolite GLT ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** l-glutamate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** c(ccc(c(=o)[o-])[n+])([o-])=o
 
* inchi-key:
 
* inchi-key:
** wegxyvfdoluulo-tuumqracsa-n
+
** whuutdbjxjrkmk-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 616.966
+
** 146.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[6.1.1.24-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[GLUTDECARBOX-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLUTKIN-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11737]]
 +
* [[RXN-12878]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-2901]]
 +
* [[RXN-6341]]
 +
* [[RXN-7737]]
 +
* [[RXN-9386]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-2921]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRANS-RXN-261]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
* [[biomass_rxn]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.5.1.9-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[3.4.17.21-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[6.3.5.6-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[FGAMSYN-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[PYRROLINECARBDEHYDROG-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11322]]
 +
* [[RXN-11737]]
 +
* [[RXN-12618]]
 +
* [[RXN-13675]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14116]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-2901]]
 +
* [[RXN-3741]]
 +
* [[RXN-6641]]
 +
* [[RXN-7737]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-6981]]
 +
* [[RXN0-6984]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRANS-RXN-261]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=l-glutamate}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-vkhmyheasa-m}}
{{#set: molecular-weight=616.966}}
+
{{#set: molecular-weight=146.122}}

Revision as of 11:16, 15 January 2021

Metabolite GLT

  • common-name:
    • l-glutamate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])([o-])=o
  • inchi-key:
    • whuutdbjxjrkmk-vkhmyheasa-m
  • molecular-weight:
    • 146.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality