Difference between revisions of "Glycerophosphodiesters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Actinorhodin-Intermediate-2 == * common-name: ** 9-hydroxy-3,5,7,11,13,15-hexaoxohexadecanoyl-[pks-acp] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite CPD-17858 == * common-name: ** ω-saturated c55 dolichol phosphate * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17858 == |
* common-name: | * common-name: | ||
− | ** | + | ** ω-saturated c55 dolichol phosphate |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c | ||
+ | * inchi-key: | ||
+ | ** ktgsdhzxakcyhm-lstwdcehsa-l | ||
+ | * molecular-weight: | ||
+ | ** 849.311 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16602]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ω-saturated c55 dolichol phosphate}} |
+ | {{#set: inchi-key=inchikey=ktgsdhzxakcyhm-lstwdcehsa-l}} | ||
+ | {{#set: molecular-weight=849.311}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-17858
- common-name:
- ω-saturated c55 dolichol phosphate
- smiles:
- cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])[o-])c
- inchi-key:
- ktgsdhzxakcyhm-lstwdcehsa-l
- molecular-weight:
- 849.311