Difference between revisions of "N-terminal-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-key: ** hpzmwtnatzpbih-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL == * common-name: ** 2-carboxy-d-arabinitol * smiles: ** c(c(c(c(c([o-])=o)(co)o)o)o)o * inchi-key: ** xondrgralzt...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-CARBOXY-D-ARABINITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-carboxy-d-arabinitol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(c(c(c([o-])=o)(co)o)o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xondrgralztvkd-zmizwqjlsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** 149 | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-carboxy-d-arabinitol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}} |
| − | {{#set: molecular-weight=149 | + | {{#set: molecular-weight=195.149}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite 2-CARBOXY-D-ARABINITOL
- common-name:
- 2-carboxy-d-arabinitol
- smiles:
- c(c(c(c(c([o-])=o)(co)o)o)o)o
- inchi-key:
- xondrgralztvkd-zmizwqjlsa-m
- molecular-weight:
- 195.149
