Difference between revisions of "BENZALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-L-arabinosides == * common-name: ** an oligosaccharide with β-l-arabinopyranose at the non-reducing end == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DATP == |
* common-name: | * common-name: | ||
| − | ** | + | ** datp |
| + | * smiles: | ||
| + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** suyvubyjarfzho-rrkcrqdmsa-j | ||
| + | * molecular-weight: | ||
| + | ** 487.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DATCY]] |
| + | * [[DATPtm]] | ||
| + | * [[DATUP]] | ||
| + | * [[RXN-14195]] | ||
| + | * [[RXN-14214]] | ||
| + | * [[RXN0-384]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DADPKIN-RXN]] | ||
| + | * [[DATPtm]] | ||
| + | * [[NDPK]] | ||
| + | * [[NDPKm]] | ||
| + | * [[RXN-14192]] | ||
| + | * [[RXN0-745]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=datp}} |
| + | {{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}} | ||
| + | {{#set: molecular-weight=487.152}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite DATP
- common-name:
- datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- suyvubyjarfzho-rrkcrqdmsa-j
- molecular-weight:
- 487.152
