Difference between revisions of "TRNA-Containing-N1-Methylguanine-9"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15370 == * common-name: ** trans-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite 2-Hexadecenoyl-ACPs == * common-name: ** a trans hexadecenoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9542 * RX...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15370 ==
+
== Metabolite 2-Hexadecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** trans-lesqueroloyl-coa
+
** a trans hexadecenoyl-[acp]
* smiles:
 
** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** fgrjeqcmqcquqf-fscwmumrsa-j
 
* molecular-weight:
 
** 1069.99
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9542]]
 +
* [[RXN-9663]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14494]]
+
* [[4.2.1.61-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-lesqueroloyl-coa}}
+
{{#set: common-name=a trans hexadecenoyl-[acp]}}
{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
 
{{#set: molecular-weight=1069.99}}
 

Revision as of 11:16, 15 January 2021

Metabolite 2-Hexadecenoyl-ACPs

  • common-name:
    • a trans hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.