Difference between revisions of "CPD-14159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...")
(Created page with "Category:metabolite == Metabolite Angiotensinogens == * common-name: ** an angiotensinogen == Reaction(s) known to consume the compound == * 3.4.23.15-RXN == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14808 ==
+
== Metabolite Angiotensinogens ==
 
* common-name:
 
* common-name:
** scyllo-inosose
+
** an angiotensinogen
* smiles:
 
** c1(c(c(c(c(c1o)o)=o)o)o)o
 
* inchi-key:
 
** vyegbdhsghxogt-hyfglkjpsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
+
* [[3.4.23.15-RXN]]
* [[RXN-13779]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[RXN-13779]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=scyllo-inosose}}
+
{{#set: common-name=an angiotensinogen}}
{{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Revision as of 11:16, 15 January 2021

Metabolite Angiotensinogens

  • common-name:
    • an angiotensinogen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality