Difference between revisions of "1-Alkenylglycerophosphoethanolamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Angiotensinogens == * common-name: ** an angiotensinogen == Reaction(s) known to consume the compound == * 3.4.23.15-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIAMINONONANOATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-diaminopelargonate |
+ | * smiles: | ||
+ | ** cc(c(cccccc([o-])=o)[n+])[n+] | ||
+ | * inchi-key: | ||
+ | ** kcegbpiygiwcdh-uhfffaoysa-o | ||
+ | * molecular-weight: | ||
+ | ** 189.277 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DAPASYN-RXN]] |
+ | * [[DETHIOBIOTIN-SYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DAPASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7,8-diaminopelargonate}} |
+ | {{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}} | ||
+ | {{#set: molecular-weight=189.277}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite DIAMINONONANOATE
- common-name:
- 7,8-diaminopelargonate
- smiles:
- cc(c(cccccc([o-])=o)[n+])[n+]
- inchi-key:
- kcegbpiygiwcdh-uhfffaoysa-o
- molecular-weight:
- 189.277