Difference between revisions of "CPD-4822"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite holo-VibB == * common-name: ** a holo-[vibb aryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-10994 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10664 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-methylsalicylate |
| + | * smiles: | ||
| + | ** cc1(=cc(=c(c=c1)o)c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** dlgbegbhxsaqoc-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 151.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10079]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-methylsalicylate}} |
| + | {{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=151.141}} | ||
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-10664
- common-name:
- 5-methylsalicylate
- smiles:
- cc1(=cc(=c(c=c1)o)c([o-])=o)
- inchi-key:
- dlgbegbhxsaqoc-uhfffaoysa-m
- molecular-weight:
- 151.141
