Difference between revisions of "CPD-11875"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** xcctyiawtas...")
(Created page with "Category:metabolite == Metabolite Long-Chain-Fatty-Acids == * common-name: ** a long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-7904 == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP ==
+
== Metabolite Long-Chain-Fatty-Acids ==
 
* common-name:
 
* common-name:
** udp
+
** a long-chain fatty acid
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** xcctyiawtasojw-xvfcmesisa-k
 
* molecular-weight:
 
** 401.14
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.198-RXN]]
+
* [[RXN-7904]]
* [[2.4.1.229-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[ATUD]]
 
* [[ATUDm]]
 
* [[DUDT]]
 
* [[R00157]]
 
* [[RXN-11627]]
 
* [[RXN-11889]]
 
* [[RXN-11890]]
 
* [[RXN-12197]]
 
* [[RXN-14841]]
 
* [[RXN-16027]]
 
* [[RXN-7873]]
 
* [[RXN0-722]]
 
* [[UDPGth]]
 
* [[UDPKIN-RXN]]
 
* [[UDPREDUCT-RXN]]
 
* [[UMPU]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
* [[FATTY-ACID-SYNTHASE-RXN]]
* [[2.4.1.101-RXN]]
+
* [[RXN-16395]]
* [[2.4.1.117-RXN]]
 
* [[2.4.1.122-RXN]]
 
* [[2.4.1.123-RXN]]
 
* [[2.4.1.134-RXN]]
 
* [[2.4.1.141-RXN]]
 
* [[2.4.1.145-RXN]]
 
* [[2.4.1.151-RXN]]
 
* [[2.4.1.155-RXN]]
 
* [[2.4.1.198-RXN]]
 
* [[2.4.1.201-RXN]]
 
* [[2.4.1.212-RXN]]
 
* [[2.4.1.223-RXN]]
 
* [[2.4.1.224-RXN]]
 
* [[2.4.1.225-RXN]]
 
* [[2.4.1.229-RXN]]
 
* [[2.4.1.38-RXN]]
 
* [[2.4.1.46-RXN]]
 
* [[2.4.1.94-RXN]]
 
* [[2.4.2.26-RXN]]
 
* [[2.4.2.38-RXN]]
 
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
* [[LACTOSE-SYNTHASE-RXN]]
 
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
* [[R00157]]
 
* [[RXN-10606]]
 
* [[RXN-10607]]
 
* [[RXN-10608]]
 
* [[RXN-10609]]
 
* [[RXN-10616]]
 
* [[RXN-10617]]
 
* [[RXN-10618]]
 
* [[RXN-10619]]
 
* [[RXN-10784]]
 
* [[RXN-11060]]
 
* [[RXN-11627]]
 
* [[RXN-11889]]
 
* [[RXN-11890]]
 
* [[RXN-12002]]
 
* [[RXN-12123]]
 
* [[RXN-12125]]
 
* [[RXN-12126]]
 
* [[RXN-12127]]
 
* [[RXN-12128]]
 
* [[RXN-12196]]
 
* [[RXN-1225]]
 
* [[RXN-13607]]
 
* [[RXN-13608]]
 
* [[RXN-14361]]
 
* [[RXN-14561]]
 
* [[RXN-14841]]
 
* [[RXN-15117]]
 
* [[RXN-15205]]
 
* [[RXN-15276]]
 
* [[RXN-15277]]
 
* [[RXN-15278]]
 
* [[RXN-16027]]
 
* [[RXN-16975]]
 
* [[RXN-18266]]
 
* [[RXN-18302]]
 
* [[RXN-4726]]
 
* [[RXN-4733]]
 
* [[RXN-6501]]
 
* [[RXN-7667]]
 
* [[RXN-7828]]
 
* [[RXN-7873]]
 
* [[RXN-8228]]
 
* [[RXN-9000]]
 
* [[RXN-9104]]
 
* [[RXN1F-461]]
 
* [[RXN1F-462]]
 
* [[RXN66-162]]
 
* [[RXN66-168]]
 
* [[RXN66-83]]
 
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
* [[TREHALOSE6PSYN-RXN]]
 
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
* [[UDPGth]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
* [[UTCY]]
 
* [[UTUP]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp}}
+
{{#set: common-name=a long-chain fatty acid}}
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
 
{{#set: molecular-weight=401.14}}
 

Revision as of 11:16, 15 January 2021

Metabolite Long-Chain-Fatty-Acids

  • common-name:
    • a long-chain fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality