Difference between revisions of "PALMITYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
(Created page with "Category:metabolite == Metabolite CPD-3725 == * common-name: ** uridine 2'3'-cyclic monophosphate * smiles: ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-3725 == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine 2'3'-cyclic monophosphate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hwdmhjdymfrxox-xvfcmesisa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 305.16 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12060]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine 2'3'-cyclic monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=305.16}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-3725
- common-name:
- uridine 2'3'-cyclic monophosphate
- smiles:
- c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
- inchi-key:
- hwdmhjdymfrxox-xvfcmesisa-m
- molecular-weight:
- 305.16
