Difference between revisions of "3-Oxosteroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7064 == * common-name: ** primary fluorescent chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2...")
(Created page with "Category:metabolite == Metabolite Phosphoserines == * common-name: ** l(or d)-o-phosphoserine == Reaction(s) known to consume the compound == * PSERPHOSPHA-RXN == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7064 ==
+
== Metabolite Phosphoserines ==
 
* common-name:
 
* common-name:
** primary fluorescent chlorophyll catabolite
+
** l(or d)-o-phosphoserine
* smiles:
 
** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
 
* inchi-key:
 
** vhqsfnuihpntmw-lryvnugjsa-m
 
* molecular-weight:
 
** 626.708
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PSERPHOSPHA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7741]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=primary fluorescent chlorophyll catabolite}}
+
{{#set: common-name=l(or d)-o-phosphoserine}}
{{#set: inchi-key=inchikey=vhqsfnuihpntmw-lryvnugjsa-m}}
 
{{#set: molecular-weight=626.708}}
 

Revision as of 11:16, 15 January 2021

Metabolite Phosphoserines

  • common-name:
    • l(or d)-o-phosphoserine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality