Difference between revisions of "CPD-15431"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Glc2Man9GlcNAc2-proteins == * common-name: ** glc2man9glcnac2-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glc2Man9GlcNAc2-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** glc2man9glcnac2-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.106-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glc2man9glcnac2-[protein]}} |
| − | |||
| − | |||
Revision as of 11:16, 15 January 2021
Contents
Metabolite Glc2Man9GlcNAc2-proteins
- common-name:
- glc2man9glcnac2-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "glc2man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
