Difference between revisions of "3-OXOPIMELOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
(Created page with "Category:metabolite == Metabolite DIMETHYL-GLYCINE == * common-name: ** n,n-dimethylglycine * smiles: ** c[n+](cc([o-])=o)c * inchi-key: ** ffdgpvchzbvarc-uhfffaoysa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19150 ==
+
== Metabolite DIMETHYL-GLYCINE ==
 
* common-name:
 
* common-name:
** (2e,5z)-dodecenoyl-coa
+
** n,n-dimethylglycine
 
* smiles:
 
* smiles:
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[n+](cc([o-])=o)c
 
* inchi-key:
 
* inchi-key:
** zsjrxhrcabosnc-shjpognxsa-j
+
** ffdgpvchzbvarc-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 941.776
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17797]]
+
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 +
* [[RXN-9680]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17796]]
+
* [[2.1.1.5-RXN]]
 +
* [[RXN-13404]]
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 +
* [[RXN-9679]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
+
{{#set: common-name=n,n-dimethylglycine}}
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}
+
{{#set: inchi-key=inchikey=ffdgpvchzbvarc-uhfffaoysa-n}}
{{#set: molecular-weight=941.776}}
+
{{#set: molecular-weight=103.121}}

Revision as of 11:17, 15 January 2021

Metabolite DIMETHYL-GLYCINE

  • common-name:
    • n,n-dimethylglycine
  • smiles:
    • c[n+](cc([o-])=o)c
  • inchi-key:
    • ffdgpvchzbvarc-uhfffaoysa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality