Difference between revisions of "CPD-17814"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
(Created page with "Category:metabolite == Metabolite CPD-14018 == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-D-GLUCOSE ==
+
== Metabolite CPD-14018 ==
 
* common-name:
 
* common-name:
** gdp-α-d-glucose
+
** icosapentaenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
+
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mvmscbbuihutgj-lrjdveewsa-l
+
** jwzlrycddxhxdl-lcmhirpzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 603.329
+
** 1047.943
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12486]]
+
* [[RXN-13430]]
 +
* [[RXN-17688]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12486]]
+
* [[RXN-12978]]
* [[RXN4FS-13]]
+
* [[RXN-17688]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-glucose}}
+
{{#set: common-name=icosapentaenoyl-coa}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
+
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
{{#set: molecular-weight=603.329}}
+
{{#set: molecular-weight=1047.943}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-14018

  • common-name:
    • icosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jwzlrycddxhxdl-lcmhirpzsa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality