Difference between revisions of "Linoleoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...") |
(Created page with "Category:metabolite == Metabolite Holo-EntB == * common-name: ** a holo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Holo-EntB == |
* common-name: | * common-name: | ||
| − | ** | + | ** a holo-[entb isochorismatase/aryl-carrier protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ENTDB-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a holo-[entb isochorismatase/aryl-carrier protein]}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite Holo-EntB
- common-name:
- a holo-[entb isochorismatase/aryl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a holo-[entb isochorismatase/aryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
