Difference between revisions of "23S-rRNA-pseudouridine1911-1915-1917"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...") |
(Created page with "Category:metabolite == Metabolite 4-PHOSPHONOOXY-THREONINE == * common-name: ** 4-phosphooxy-l-threonine * smiles: ** c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-] * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-PHOSPHONOOXY-THREONINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-phosphooxy-l-threonine |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fkhakijokdgeii-gbxijsldsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 213.083 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PSERTRANSAMPYR-RXN]] |
− | * [[ | + | * [[RXN-14125]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PSERTRANSAMPYR-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-phosphooxy-l-threonine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fkhakijokdgeii-gbxijsldsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=213.083}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite 4-PHOSPHONOOXY-THREONINE
- common-name:
- 4-phosphooxy-l-threonine
- smiles:
- c(=o)([o-])c([n+])c(o)cop([o-])(=o)[o-]
- inchi-key:
- fkhakijokdgeii-gbxijsldsa-l
- molecular-weight:
- 213.083