Difference between revisions of "CPD-12124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=n...")
(Created page with "Category:metabolite == Metabolite Oxidized-NrdH-Proteins == * common-name: ** an oxidized nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FAD ==
+
== Metabolite Oxidized-NrdH-Proteins ==
 
* common-name:
 
* common-name:
** fad
+
** an oxidized nrdh glutaredoxin-like protein
* smiles:
 
** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
 
* inchi-key:
 
** imgvnjnccgxbhd-uybvjogssa-k
 
* molecular-weight:
 
** 782.533
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOA120OR]]
 
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[FAD-PYROPHOSPHATASE-RXN]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-11695]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOAD1f]]
+
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
* [[FAD-PYROPHOSPHATASE-RXN]]
+
* [[RXN0-722]]
* [[FADSYN-RXN]]
+
* [[RXN0-747]]
* [[PPCOAOm]]
+
* [[RXN0-748]]
* [[RXN-11695]]
 
* [[RXN-14264]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fad}}
+
{{#set: common-name=an oxidized nrdh glutaredoxin-like protein}}
{{#set: inchi-key=inchikey=imgvnjnccgxbhd-uybvjogssa-k}}
 
{{#set: molecular-weight=782.533}}
 

Revision as of 11:17, 15 January 2021

Metabolite Oxidized-NrdH-Proteins

  • common-name:
    • an oxidized nrdh glutaredoxin-like protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality