Difference between revisions of "HISTIDINAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DAMP == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o * inchi-key: ** khwchtkseggwex-rr...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS == * common-name: ** prostaglandin e2 * smiles: ** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1) * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DAMP ==
+
== Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS ==
 
* common-name:
 
* common-name:
** damp
+
** prostaglandin e2
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
+
** cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
** khwchtkseggwex-rrkcrqdmsa-l
+
** xeybrnlfezdvaw-arsrfyassa-m
 
* molecular-weight:
 
* molecular-weight:
** 329.208
+
** 351.462
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDAM]]
+
* [[1.1.1.141-RXN]]
* [[DAMPH]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
* [[DEOXYADENYLATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAMPH]]
+
* [[1.1.1.141-RXN]]
* [[RXN-14195]]
+
* [[PROSTAGLANDIN-E-SYNTHASE-RXN]]
* [[RXN-14215]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
* [[RXN0-384]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=damp}}
+
{{#set: common-name=prostaglandin e2}}
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
+
{{#set: inchi-key=inchikey=xeybrnlfezdvaw-arsrfyassa-m}}
{{#set: molecular-weight=329.208}}
+
{{#set: molecular-weight=351.462}}

Revision as of 11:17, 15 January 2021

Metabolite 5Z13E-15S-1115-DIHYDROXY-9-OXOPROS

  • common-name:
    • prostaglandin e2
  • smiles:
    • cccccc(o)c=cc1(c(cc=ccccc(=o)[o-])c(=o)cc(o)1)
  • inchi-key:
    • xeybrnlfezdvaw-arsrfyassa-m
  • molecular-weight:
    • 351.462

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality