Difference between revisions of "Reduced-ferredoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18319 == * common-name: ** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate * smiles: ** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]...") |
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14596 == |
* common-name: | * common-name: | ||
| − | ** | + | ** neolinustatin |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wosyvgndrybqcq-bargltkpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 423.416 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13603]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=neolinustatin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wosyvgndrybqcq-bargltkpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=423.416}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite CPD-14596
- common-name:
- neolinustatin
- smiles:
- ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
- inchi-key:
- wosyvgndrybqcq-bargltkpsa-n
- molecular-weight:
- 423.416
