Difference between revisions of "UROCANATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9958 == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc...") |
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CDP-ETHANOLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cdp-ethanolamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wvimueuqjfpndk-pebgctimsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 445.239 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] | ||
| + | * [[RXN-17731]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.7.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cdp-ethanolamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=445.239}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CDP-ETHANOLAMINE
- common-name:
- cdp-ethanolamine
- smiles:
- c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
- inchi-key:
- wvimueuqjfpndk-pebgctimsa-m
- molecular-weight:
- 445.239
