Difference between revisions of "2-Palmitoyl-L-Phosphatidate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytosine-34-tRNA-Precursors == * common-name: ** a cytosine34 in trna precursor == Reaction(s) known to consume the compound == * RXN-1...") |
(Created page with "Category:metabolite == Metabolite CPD-15152 == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15152 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1) | ||
| + | * inchi-key: | ||
| + | ** aftbilpwmusgin-mycgwmctsa-n | ||
| + | * molecular-weight: | ||
| + | ** 683.068 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14177]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}} |
| + | {{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}} | ||
| + | {{#set: molecular-weight=683.068}} | ||
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD-15152
- common-name:
- 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
- inchi-key:
- aftbilpwmusgin-mycgwmctsa-n
- molecular-weight:
- 683.068
