Difference between revisions of "D-Glucosyl-12-diacyl-glycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...") |
(Created page with "Category:metabolite == Metabolite O-Sialoglycoproteins == * common-name: ** a o-sialoglycoprotein == Reaction(s) known to consume the compound == * 3.4.24.57-RXN == Re...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite O-Sialoglycoproteins == |
* common-name: | * common-name: | ||
− | ** | + | ** a o-sialoglycoprotein |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.24.57-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a o-sialoglycoprotein}} |
− | |||
− |
Revision as of 11:18, 15 January 2021
Contents
Metabolite O-Sialoglycoproteins
- common-name:
- a o-sialoglycoprotein