Difference between revisions of "D-Glucosyl-12-diacyl-glycerols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...")
(Created page with "Category:metabolite == Metabolite O-Sialoglycoproteins == * common-name: ** a o-sialoglycoprotein == Reaction(s) known to consume the compound == * 3.4.24.57-RXN == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-380 ==
+
== Metabolite O-Sialoglycoproteins ==
 
* common-name:
 
* common-name:
** 3-sulfopyruvate
+
** a o-sialoglycoprotein
* smiles:
 
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
 
* inchi-key:
 
** buthmsuebypmkj-uhfffaoysa-l
 
* molecular-weight:
 
** 166.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R230-RXN]]
+
* [[3.4.24.57-RXN]]
* [[RXN-11737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R230-RXN]]
 
* [[RXN-11737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfopyruvate}}
+
{{#set: common-name=a o-sialoglycoprotein}}
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
 
{{#set: molecular-weight=166.105}}
 

Revision as of 11:18, 15 January 2021

Metabolite O-Sialoglycoproteins

  • common-name:
    • a o-sialoglycoprotein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality