Difference between revisions of "MYRICETIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7013 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c...") |
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11770 == |
| + | * common-name: | ||
| + | ** 7,8-dihydromonapterin | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** yqifamynggotfb-njgyiypdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.233 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10857]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydromonapterin}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}} |
| + | {{#set: molecular-weight=255.233}} | ||
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD-11770
- common-name:
- 7,8-dihydromonapterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-njgyiypdsa-n
- molecular-weight:
- 255.233
