Difference between revisions of "PYRIDOXAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11770 == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifamynggotfb...") |
(Created page with "Category:metabolite == Metabolite CPD-713 == * common-name: ** 6-oxocampestanol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-713 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-oxocampestanol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nbjzgnfizzwboj-jshjxqbasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 416.686 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-715]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-oxocampestanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nbjzgnfizzwboj-jshjxqbasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.686}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD-713
- common-name:
- 6-oxocampestanol
- smiles:
- cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- nbjzgnfizzwboj-jshjxqbasa-n
- molecular-weight:
- 416.686
