Difference between revisions of "INDOLE-3-GLYCOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-Cysteine-Desulfurase-persulfide == * common-name: ** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite CPD-13534 == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-Cysteine-Desulfurase-persulfide ==
+
== Metabolite CPD-13534 ==
 
* common-name:
 
* common-name:
** an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine
+
** 3-oxopentanoyl-coa
 +
* smiles:
 +
** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** wioqnwtzboqteu-zmhdxicwsa-j
 +
* molecular-weight:
 +
** 861.604
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12473]]
+
* [[RXN-12561]]
* [[RXN-12587]]
 
* [[RXN-14382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12587]]
+
* [[RXN-12560]]
* [[RXN0-308]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [l-cysteine desulfurase]-s-sulfanyl-l-cysteine}}
+
{{#set: common-name=3-oxopentanoyl-coa}}
 +
{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
 +
{{#set: molecular-weight=861.604}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-13534

  • common-name:
    • 3-oxopentanoyl-coa
  • smiles:
    • ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wioqnwtzboqteu-zmhdxicwsa-j
  • molecular-weight:
    • 861.604

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality