Difference between revisions of "3-HYDROXY-3-METHYL-GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])...")
(Created page with "Category:metabolite == Metabolite RETINAL == * common-name: ** all-trans-retinal * smiles: ** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o * inchi-key: ** ncycyzxnizjoki-o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13855 ==
+
== Metabolite RETINAL ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-diphosphate
+
** all-trans-retinal
 
* smiles:
 
* smiles:
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
+
** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o
 
* inchi-key:
 
* inchi-key:
** sbasprrecyvbrf-kqynxxcusa-l
+
** ncycyzxnizjoki-ovsjkpmpsa-n
 
* molecular-weight:
 
* molecular-weight:
** 455.214
+
** 284.441
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12817]]
+
* [[RETINOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-10841]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12817]]
+
* [[RETINOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-10841]]
 +
* [[RXN-11783]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
+
{{#set: common-name=all-trans-retinal}}
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=ncycyzxnizjoki-ovsjkpmpsa-n}}
{{#set: molecular-weight=455.214}}
+
{{#set: molecular-weight=284.441}}

Revision as of 11:18, 15 January 2021

Metabolite RETINAL

  • common-name:
    • all-trans-retinal
  • smiles:
    • cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o
  • inchi-key:
    • ncycyzxnizjoki-ovsjkpmpsa-n
  • molecular-weight:
    • 284.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality