Difference between revisions of "D-MYO-INOSITOL-13-BISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Alpha-D-Mannosides == * common-name: ** an α-d-mannoside == Reaction(s) known to consume the compound == * 3.2.1.24-RXN == Reac...")
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Alpha-D-Mannosides ==
+
== Metabolite CPD-316 ==
 
* common-name:
 
* common-name:
** an α-d-mannoside
+
** reduced riboflavin
 +
* smiles:
 +
** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
 +
* inchi-key:
 +
** utkdoucgqvljin-pigzvrmjsa-n
 +
* molecular-weight:
 +
** 378.384
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.24-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 +
* [[RXN-12445]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an α-d-mannoside}}
+
{{#set: common-name=reduced riboflavin}}
 +
{{#set: inchi-key=inchikey=utkdoucgqvljin-pigzvrmjsa-n}}
 +
{{#set: molecular-weight=378.384}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-316

  • common-name:
    • reduced riboflavin
  • smiles:
    • cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c)
  • inchi-key:
    • utkdoucgqvljin-pigzvrmjsa-n
  • molecular-weight:
    • 378.384

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality