Difference between revisions of "Carboxylates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-Asparagine == * common-name: ** a [protein]-l-asparagine == Reaction(s) known to consume the compound == * 2.4.1.119-RXN *...")
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-L-Asparagine ==
+
== Metabolite TTP ==
 
* common-name:
 
* common-name:
** a [protein]-l-asparagine
+
** dttp
 +
* smiles:
 +
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
 +
* inchi-key:
 +
** nhvnxkfizysceb-xlpzgreqsa-j
 +
* molecular-weight:
 +
** 478.139
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.119-RXN]]
+
* [[DTTGY]]
* [[2.4.1.94-RXN]]
+
* [[DTTPtm]]
* [[RXN-16761]]
+
* [[DTTUP]]
 +
* [[RXN-14200]]
 +
* [[RXN0-5107]]
 +
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.94-RXN]]
+
* [[ATDTD]]
* [[RXN-16761]]
+
* [[ATDTDm]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTTPtm]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-asparagine}}
+
{{#set: common-name=dttp}}
 +
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
 +
{{#set: molecular-weight=478.139}}

Revision as of 11:19, 15 January 2021

Metabolite TTP

  • common-name:
    • dttp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
  • inchi-key:
    • nhvnxkfizysceb-xlpzgreqsa-j
  • molecular-weight:
    • 478.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality