Difference between revisions of "CPD-18346"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-332 == * common-name: ** 2-carboxy-cerotoyl-coa * smiles: ** ccccccccccccccccccccccccc(c([o-])=o)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(...") |
(Created page with "Category:metabolite == Metabolite CPD-9038 == * common-name: ** precorrin-1 * smiles: ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9038 == |
* common-name: | * common-name: | ||
− | ** | + | ** precorrin-1 |
* smiles: | * smiles: | ||
− | ** | + | ** cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cjlvuwulfkhgfb-nzcajupmsa-f |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 842.768 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8675]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UROPORIIIMETHYLTRANSA-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=precorrin-1}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cjlvuwulfkhgfb-nzcajupmsa-f}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=842.768}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-9038
- common-name:
- precorrin-1
- smiles:
- cc3(c4(=cc5(=c(c(ccc([o-])=o)=c(cc1(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n1)cc2(nc(=c(cc([o-])=o)c=2ccc([o-])=o)cc(c3ccc(=o)[o-])=n4)))n5)cc([o-])=o)))(cc([o-])=o)
- inchi-key:
- cjlvuwulfkhgfb-nzcajupmsa-f
- molecular-weight:
- 842.768