Difference between revisions of "CPD-160"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite 5-10-METHENYL-THF == * common-name: ** 5,10-methenyltetrahydrofolate mono-l-glutamate * smiles: ** c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TTP ==
+
== Metabolite 5-10-METHENYL-THF ==
 
* common-name:
 
* common-name:
** dttp
+
** 5,10-methenyltetrahydrofolate mono-l-glutamate
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
+
** c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
 
* inchi-key:
 
* inchi-key:
** nhvnxkfizysceb-xlpzgreqsa-j
+
** meanfmoqmxymct-olzocxbdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 478.139
+
** 454.421
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTTGY]]
+
* [[METHFth]]
* [[DTTPtm]]
+
* [[MTHFD2]]
* [[DTTUP]]
+
* [[MTHFD2i]]
* [[RXN-14200]]
 
* [[RXN0-5107]]
 
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDTD]]
+
* [[FGFTh]]
* [[ATDTDm]]
+
* [[METHFth]]
* [[DTDPKIN-RXN]]
+
* [[MTHFCx]]
* [[DTTPtm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dttp}}
+
{{#set: common-name=5,10-methenyltetrahydrofolate mono-l-glutamate}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
+
{{#set: inchi-key=inchikey=meanfmoqmxymct-olzocxbdsa-m}}
{{#set: molecular-weight=478.139}}
+
{{#set: molecular-weight=454.421}}

Revision as of 11:19, 15 January 2021

Metabolite 5-10-METHENYL-THF

  • common-name:
    • 5,10-methenyltetrahydrofolate mono-l-glutamate
  • smiles:
    • c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
  • inchi-key:
    • meanfmoqmxymct-olzocxbdsa-m
  • molecular-weight:
    • 454.421

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality