Difference between revisions of "CPD1G-332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite REDUCED-MENAQUINONE == * common-name: ** menaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c...")
(Created page with "Category:metabolite == Metabolite CDP-2-3-4-Saturated-Diacylglycerols == * common-name: ** a cdp-2,3,4-saturated-diacylglycerol == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite REDUCED-MENAQUINONE ==
+
== Metabolite CDP-2-3-4-Saturated-Diacylglycerols ==
 
* common-name:
 
* common-name:
** menaquinol-8
+
** a cdp-2,3,4-saturated-diacylglycerol
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2))
 
* inchi-key:
 
** oiezrvbfvpgodt-wqwycsgdsa-n
 
* molecular-weight:
 
** 719.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+
* [[RXN0-5515]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-8}}
+
{{#set: common-name=a cdp-2,3,4-saturated-diacylglycerol}}
{{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}}
 
{{#set: molecular-weight=719.144}}
 

Revision as of 11:19, 15 January 2021

Metabolite CDP-2-3-4-Saturated-Diacylglycerols

  • common-name:
    • a cdp-2,3,4-saturated-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality